natclrk187 natclrk187

17-05-2023
Mathematics

contestada

Let sin A = 1/3 where A terminates in Quadrant 1, and let cos B = 2/3, where B terminates in Quadrant 4. Using the identity:

cos(A-B)=cosACosB+sinAsinB

find cos(A-B)

Let sin A 13 where A terminates in Quadrant 1 and let cos B 23 where B terminates in Quadrant 4 Using the identity cosABcosACosBsinAsinB find cosAB class=

Respuesta :

Otras preguntas

The diameter of a circle is 18 miles. What is the circle's area? Use 3.14 for ?

ZG Jewelers purchased fashion bracelets for $38.87. This jewelry store regularly marks up fashion merchandise 52% of the selling price. What is theminimum selli

it takes 21 minutes for 5 people to paint 7 walls. how many minutes does it take 3 people to paint 5 walls?

Parallelogram A has a base of 4 cm and a height of 9 cm. Which figure described below has the same area as parallelogram A? A rectangle 6 cm long and 5 cm wide.

what issue did the missouri compromise resolve?

Calculate the mass in grams of 5.14×10^24 molecules of propane. The chemical formula for propane is C3H8.

WILL MARK BRAINIEST How does increasing the size of an object affect its volume-to-surfacearea ratio?

|4x−1|=7 PLEEEASE HELP!!!

What is connotation? A. the origin of a word B. the literal definition of a word C. the ideas, images, and feelings associated with a word D. the part of speech

Given: Tangents LA and LB m∠AOB=110° Find: m∠ALO.