heyimwormy65 heyimwormy65
  • 20-06-2019
  • Chemistry
contestada

Write the complete balanced equation for the reaction between lead (IV) oxide (PbO2) and water (H2O).

Respuesta :

NeilIceland
NeilIceland NeilIceland
  • 20-06-2019
PbO2+2H2O=Pb(OH)2+O2(gas)
Answer Link

Otras preguntas

State the four principles of Dalton's atomic theory
What is a reason many people were willing to endure the hardships of moving to and settling in the West?
American morale was lifted during the Depression by the fireside chats of President
given the sides 4, 6, 12, what type of triangle is this acute right obtues or not a tringle
Calculate the surface area of sphere with a radius of 5 inches. (4πr2)
How to write 1.59 as a mix number
Eduardo started a business selling sporting goods. He spent $7500 to obtain his merchandise, and it costs him $300 per week for general expenses. He earns $850
How did Spain and France take different approaches to helping in the American Revolution?
The estimated product of two numbers is 2,800 what are they?
What kind of clause is the underlined group of words? We're walking to the community center, which is seven blocks away. underlined = which is seven blocks a