Wakinchone Wakinchone

19-05-2021
Physics

contestada

What is SI unit of Work?

Respuesta :

rishavbasista rishavbasista

19-05-2021

Answer:

The SI unit of work is Joule

Answer Link

starcherarielle24 starcherarielle24

19-05-2021

Answer:

S.I. unit of work is Joule. Work done when a force of 1 Newton displaces the body through a distance of 1 metre in the direction of force.

Explanation:

Answer Link

Otras preguntas

Materials that conduct heat and electricity well in the solid state result when: 1. metals bond with metals 2. any type of element bonds with any other 3. non-m

Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=ch(

What factors encouraged commercial growth in the post-classical era?

Explain why you can use subtraction to solve a division problem

Whicl ordered pair makes the inequality true? X+y>8

Please anwser will rate & if 2 peeps anwser will give out brainly!!!!!!!!!!!!!!!!!!

Which method(s) would produce the following output if they were passed the parameter, "hamster"? hamster hamste hamst hams ham ha h I. public static void myster

Why is Esperanza so worried about the strikers effort ?

A study of the amount of time it takes a mechanic to rebuild the transmission for a 2010 chevrolet colorado shows that the mean is 8.4 hours and the standard de

Name the three processes Carbon cycles through in the biosphere.